/*! Provides the definition of high level arguments from CLI flags. */ use std::{ collections::HashSet, path::{Path, PathBuf}, }; use { bstr::BString, grep::printer::{ColorSpecs, SummaryKind}, }; use crate::{ flags::lowargs::{ BinaryMode, BoundaryMode, BufferMode, CaseMode, ColorChoice, ContextMode, ContextSeparator, EncodingMode, EngineChoice, FieldContextSeparator, FieldMatchSeparator, LowArgs, MmapMode, Mode, PatternSource, SearchMode, SortMode, SortModeKind, TypeChange, }, haystack::{Haystack, HaystackBuilder}, search::{PatternMatcher, Printer, SearchWorker, SearchWorkerBuilder}, }; /// A high level representation of CLI arguments. /// /// The distinction between low and high level arguments is somewhat arbitrary /// and wishy washy. The main idea here is that high level arguments generally /// require all of CLI parsing to be finished. For example, one cannot /// construct a glob matcher until all of the glob patterns are known. /// /// So while low level arguments are collected during parsing itself, high /// level arguments aren't created until parsing has completely finished. #[derive(Debug)] pub(crate) struct HiArgs { binary: BinaryDetection, boundary: Option, buffer: BufferMode, byte_offset: bool, case: CaseMode, color: ColorChoice, colors: grep::printer::ColorSpecs, column: bool, context: ContextMode, context_separator: ContextSeparator, crlf: bool, dfa_size_limit: Option, encoding: EncodingMode, engine: EngineChoice, field_context_separator: FieldContextSeparator, field_match_separator: FieldMatchSeparator, file_separator: Option>, fixed_strings: bool, follow: bool, globs: ignore::overrides::Override, heading: bool, hidden: bool, hyperlink_config: grep::printer::HyperlinkConfig, ignore_file_case_insensitive: bool, ignore_file: Vec, include_zero: bool, invert_match: bool, is_terminal_stdout: bool, line_number: bool, max_columns: Option, max_columns_preview: bool, max_count: Option, max_depth: Option, max_filesize: Option, mmap_choice: grep::searcher::MmapChoice, mode: Mode, multiline: bool, multiline_dotall: bool, no_ignore_dot: bool, no_ignore_exclude: bool, no_ignore_files: bool, no_ignore_global: bool, no_ignore_parent: bool, no_ignore_vcs: bool, no_require_git: bool, no_unicode: bool, null_data: bool, one_file_system: bool, only_matching: bool, path_separator: Option, paths: Paths, path_terminator: Option, patterns: Patterns, pre: Option, pre_globs: ignore::overrides::Override, quiet: bool, quit_after_match: bool, regex_size_limit: Option, replace: Option, search_zip: bool, sort: Option, stats: Option, stop_on_nonmatch: bool, threads: usize, trim: bool, types: ignore::types::Types, vimgrep: bool, with_filename: bool, } impl HiArgs { /// Convert low level arguments into high level arguments. /// /// This process can fail for a variety of reasons. For example, invalid /// globs or some kind of environment issue. pub(crate) fn from_low_args(mut low: LowArgs) -> anyhow::Result { // Callers should not be trying to convert low-level arguments when // a short-circuiting special mode is present. assert_eq!(None, low.special, "special mode demands short-circuiting"); // If the sorting mode isn't supported, then we bail loudly. I'm not // sure if this is the right thing to do. We could silently "not sort" // as well. If we wanted to go that route, then we could just set // `low.sort = None` if `supported()` returns an error. if let Some(ref sort) = low.sort { sort.supported()?; } // We modify the mode in-place on `low` so that subsequent conversions // see the correct mode. match low.mode { Mode::Search(ref mut mode) => match *mode { // treat `-v --count-matches` as `-v --count` SearchMode::CountMatches if low.invert_match => { *mode = SearchMode::Count; } // treat `-o --count` as `--count-matches` SearchMode::Count if low.only_matching => { *mode = SearchMode::CountMatches; } _ => {} }, _ => {} } let mut state = State::new()?; let patterns = Patterns::from_low_args(&mut state, &mut low)?; let paths = Paths::from_low_args(&mut state, &patterns, &mut low)?; let binary = BinaryDetection::from_low_args(&state, &low); let colors = take_color_specs(&mut state, &mut low); let hyperlink_config = take_hyperlink_config(&mut state, &mut low)?; let stats = stats(&low); let types = types(&low)?; let globs = globs(&state, &low)?; let pre_globs = preprocessor_globs(&state, &low)?; let color = match low.color { ColorChoice::Auto if !state.is_terminal_stdout => { ColorChoice::Never } _ => low.color, }; let column = low.column.unwrap_or(low.vimgrep); let heading = match low.heading { None => !low.vimgrep && state.is_terminal_stdout, Some(false) => false, Some(true) => !low.vimgrep, }; let path_terminator = if low.null { Some(b'\x00') } else { None }; let quit_after_match = stats.is_none() && low.quiet; let threads = if low.sort.is_some() || paths.is_one_file { 1 } else if let Some(threads) = low.threads { threads } else { std::thread::available_parallelism().map_or(1, |n| n.get()).min(12) }; log::debug!("using {threads} thread(s)"); let with_filename = low .with_filename .unwrap_or_else(|| low.vimgrep || !paths.is_one_file); let file_separator = match low.mode { Mode::Search(SearchMode::Standard) => { if heading { Some(b"".to_vec()) } else if let ContextMode::Limited(ref limited) = low.context { let (before, after) = limited.get(); if before > 0 || after > 0 { low.context_separator.clone().into_bytes() } else { None } } else { None } } _ => None, }; let line_number = low.line_number.unwrap_or_else(|| { if low.quiet { return false; } let Mode::Search(ref search_mode) = low.mode else { return false }; match *search_mode { SearchMode::FilesWithMatches | SearchMode::FilesWithoutMatch | SearchMode::Count | SearchMode::CountMatches => return false, SearchMode::JSON => return true, SearchMode::Standard => { // A few things can imply counting line numbers. In // particular, we generally want to show line numbers by // default when printing to a tty for human consumption, // except for one interesting case: when we're only // searching stdin. This makes pipelines work as expected. (state.is_terminal_stdout && !paths.is_only_stdin()) || column || low.vimgrep } } }); let mmap_choice = { // SAFETY: Memory maps are difficult to impossible to encapsulate // safely in a portable way that doesn't simultaneously negate some // of the benfits of using memory maps. For ripgrep's use, we never // mutate a memory map and generally never store the contents of // memory map in a data structure that depends on immutability. // Generally speaking, the worst thing that can happen is a SIGBUS // (if the underlying file is truncated while reading it), which // will cause ripgrep to abort. This reasoning should be treated as // suspect. let maybe = unsafe { grep::searcher::MmapChoice::auto() }; let never = grep::searcher::MmapChoice::never(); match low.mmap { MmapMode::Auto => { if paths.paths.len() <= 10 && paths.paths.iter().all(|p| p.is_file()) { // If we're only searching a few paths and all of them // are files, then memory maps are probably faster. maybe } else { never } } MmapMode::AlwaysTryMmap => maybe, MmapMode::Never => never, } }; Ok(HiArgs { mode: low.mode, patterns, paths, binary, boundary: low.boundary, buffer: low.buffer, byte_offset: low.byte_offset, case: low.case, color, colors, column, context: low.context, context_separator: low.context_separator, crlf: low.crlf, dfa_size_limit: low.dfa_size_limit, encoding: low.encoding, engine: low.engine, field_context_separator: low.field_context_separator, field_match_separator: low.field_match_separator, file_separator, fixed_strings: low.fixed_strings, follow: low.follow, heading, hidden: low.hidden, hyperlink_config, ignore_file: low.ignore_file, ignore_file_case_insensitive: low.ignore_file_case_insensitive, include_zero: low.include_zero, invert_match: low.invert_match, is_terminal_stdout: state.is_terminal_stdout, line_number, max_columns: low.max_columns, max_columns_preview: low.max_columns_preview, max_count: low.max_count, max_depth: low.max_depth, max_filesize: low.max_filesize, mmap_choice, multiline: low.multiline, multiline_dotall: low.multiline_dotall, no_ignore_dot: low.no_ignore_dot, no_ignore_exclude: low.no_ignore_exclude, no_ignore_files: low.no_ignore_files, no_ignore_global: low.no_ignore_global, no_ignore_parent: low.no_ignore_parent, no_ignore_vcs: low.no_ignore_vcs, no_require_git: low.no_require_git, no_unicode: low.no_unicode, null_data: low.null_data, one_file_system: low.one_file_system, only_matching: low.only_matching, globs, path_separator: low.path_separator, path_terminator, pre: low.pre, pre_globs, quiet: low.quiet, quit_after_match, regex_size_limit: low.regex_size_limit, replace: low.replace, search_zip: low.search_zip, sort: low.sort, stats, stop_on_nonmatch: low.stop_on_nonmatch, threads, trim: low.trim, types, vimgrep: low.vimgrep, with_filename, }) } /// Returns a writer for printing buffers to stdout. /// /// This is intended to be used from multiple threads. Namely, a buffer /// writer can create new buffers that are sent to threads. Threads can /// then independently write to the buffers. Once a unit of work is /// complete, a buffer can be given to the buffer writer to write to /// stdout. pub(crate) fn buffer_writer(&self) -> termcolor::BufferWriter { let mut wtr = termcolor::BufferWriter::stdout(self.color.to_termcolor()); wtr.separator(self.file_separator.clone()); wtr } /// Returns true when ripgrep had to guess to search the current working /// directory. That is, it's true when ripgrep is called without any file /// paths or directories to search. /// /// Other than changing how file paths are printed (i.e., without the /// leading `./`), it's also useful to know for diagnostic reasons. For /// example, ripgrep will print an error message when nothing is searched /// since it's possible the ignore rules in play are too aggressive. But /// this warning is only emitted when ripgrep was called without any /// explicit file paths since otherwise the warning would likely be too /// aggressive. pub(crate) fn has_implicit_path(&self) -> bool { self.paths.has_implicit_path } /// Return a properly configured builder for constructing haystacks. /// /// The builder can be used to turn a directory entry (from the `ignore` /// crate) into something that can be searched. pub(crate) fn haystack_builder(&self) -> HaystackBuilder { let mut builder = HaystackBuilder::new(); builder.strip_dot_prefix(self.paths.has_implicit_path); builder } /// Return the matcher that should be used for searching using the engine /// choice made by the user. /// /// If there was a problem building the matcher (e.g., a syntax error), /// then this returns an error. pub(crate) fn matcher(&self) -> anyhow::Result { match self.engine { EngineChoice::Default => match self.matcher_rust() { Ok(m) => Ok(m), Err(err) => { anyhow::bail!(suggest_other_engine(err.to_string())); } }, EngineChoice::PCRE2 => Ok(self.matcher_pcre2()?), EngineChoice::Auto => { let rust_err = match self.matcher_rust() { Ok(m) => return Ok(m), Err(err) => err, }; log::debug!( "error building Rust regex in hybrid mode:\n{rust_err}", ); let pcre_err = match self.matcher_pcre2() { Ok(m) => return Ok(m), Err(err) => err, }; let divider = "~".repeat(79); anyhow::bail!( "regex could not be compiled with either the default \ regex engine or with PCRE2.\n\n\ default regex engine error:\n\ {divider}\n\ {rust_err}\n\ {divider}\n\n\ PCRE2 regex engine error:\n{pcre_err}", ); } } } /// Build a matcher using PCRE2. /// /// If there was a problem building the matcher (such as a regex syntax /// error), then an error is returned. /// /// If the `pcre2` feature is not enabled then this always returns an /// error. fn matcher_pcre2(&self) -> anyhow::Result { #[cfg(feature = "pcre2")] { let mut builder = grep::pcre2::RegexMatcherBuilder::new(); builder.multi_line(true).fixed_strings(self.fixed_strings); match self.case { CaseMode::Sensitive => builder.caseless(false), CaseMode::Insensitive => builder.caseless(true), CaseMode::Smart => builder.case_smart(true), }; if let Some(ref boundary) = self.boundary { match *boundary { BoundaryMode::Line => builder.whole_line(true), BoundaryMode::Word => builder.word(true), }; } // For whatever reason, the JIT craps out during regex compilation with // a "no more memory" error on 32 bit systems. So don't use it there. if cfg!(target_pointer_width = "64") { builder .jit_if_available(true) // The PCRE2 docs say that 32KB is the default, and that 1MB // should be big enough for anything. But let's crank it to // 10MB. .max_jit_stack_size(Some(10 * (1 << 20))); } if !self.no_unicode { builder.utf(true).ucp(true); } if self.multiline { builder.dotall(self.multiline_dotall); } if self.crlf { builder.crlf(true); } let m = builder.build_many(&self.patterns.patterns)?; Ok(PatternMatcher::PCRE2(m)) } #[cfg(not(feature = "pcre2"))] { Err(anyhow::anyhow!( "PCRE2 is not available in this build of ripgrep" )) } } /// Build a matcher using Rust's regex engine. /// /// If there was a problem building the matcher (such as a regex syntax /// error), then an error is returned. fn matcher_rust(&self) -> anyhow::Result { let mut builder = grep::regex::RegexMatcherBuilder::new(); builder .multi_line(true) .unicode(!self.no_unicode) .octal(false) .fixed_strings(self.fixed_strings); match self.case { CaseMode::Sensitive => builder.case_insensitive(false), CaseMode::Insensitive => builder.case_insensitive(true), CaseMode::Smart => builder.case_smart(true), }; if let Some(ref boundary) = self.boundary { match *boundary { BoundaryMode::Line => builder.whole_line(true), BoundaryMode::Word => builder.word(true), }; } if self.multiline { builder.dot_matches_new_line(self.multiline_dotall); if self.crlf { builder.crlf(true).line_terminator(None); } } else { builder.line_terminator(Some(b'\n')).dot_matches_new_line(false); if self.crlf { builder.crlf(true); } // We don't need to set this in multiline mode since mulitline // matchers don't use optimizations related to line terminators. // Moreover, a mulitline regex used with --null-data should // be allowed to match NUL bytes explicitly, which this would // otherwise forbid. if self.null_data { builder.line_terminator(Some(b'\x00')); } } if let Some(limit) = self.regex_size_limit { builder.size_limit(limit); } if let Some(limit) = self.dfa_size_limit { builder.dfa_size_limit(limit); } let m = match builder.build_many(&self.patterns.patterns) { Ok(m) => m, Err(err) => anyhow::bail!(suggest_multiline(err.to_string())), }; Ok(PatternMatcher::RustRegex(m)) } /// Returns true if some non-zero number of matches is believed to be /// possible. /// /// When this returns false, it is impossible for ripgrep to ever report /// a match. pub(crate) fn matches_possible(&self) -> bool { if self.patterns.patterns.is_empty() { return false; } if self.max_count == Some(0) { return false; } true } /// Returns the "mode" that ripgrep should operate in. /// /// This is generally useful for determining what action ripgrep should /// take. The main mode is of course to "search," but there are other /// non-search modes such as `--type-list` and `--files`. pub(crate) fn mode(&self) -> Mode { self.mode } /// Returns a builder for constructing a "path printer." /// /// This is useful for the `--files` mode in ripgrep, where the printer /// just needs to emit paths and not need to worry about the functionality /// of searching. pub(crate) fn path_printer_builder( &self, ) -> grep::printer::PathPrinterBuilder { let mut builder = grep::printer::PathPrinterBuilder::new(); builder .color_specs(self.colors.clone()) .hyperlink(self.hyperlink_config.clone()) .separator(self.path_separator.clone()) .terminator(self.path_terminator.unwrap_or(b'\n')); builder } /// Returns a printer for the given search mode. /// /// This chooses which printer to build (JSON, summary or standard) based /// on the search mode given. pub(crate) fn printer( &self, search_mode: SearchMode, wtr: W, ) -> Printer { let summary_kind = if self.quiet { SummaryKind::Quiet } else { match search_mode { SearchMode::FilesWithMatches => SummaryKind::PathWithMatch, SearchMode::FilesWithoutMatch => SummaryKind::PathWithoutMatch, SearchMode::Count => SummaryKind::Count, SearchMode::CountMatches => SummaryKind::CountMatches, SearchMode::JSON => { return Printer::JSON(self.printer_json(wtr)) } SearchMode::Standard => { return Printer::Standard(self.printer_standard(wtr)) } } }; Printer::Summary(self.printer_summary(wtr, summary_kind)) } /// Builds a JSON printer. fn printer_json( &self, wtr: W, ) -> grep::printer::JSON { grep::printer::JSONBuilder::new() .pretty(false) .max_matches(self.max_count) .always_begin_end(false) .build(wtr) } /// Builds a "standard" grep printer where matches are printed as plain /// text lines. fn printer_standard( &self, wtr: W, ) -> grep::printer::Standard { let mut builder = grep::printer::StandardBuilder::new(); builder .byte_offset(self.byte_offset) .color_specs(self.colors.clone()) .column(self.column) .heading(self.heading) .hyperlink(self.hyperlink_config.clone()) .max_columns_preview(self.max_columns_preview) .max_columns(self.max_columns) .max_matches(self.max_count) .only_matching(self.only_matching) .path(self.with_filename) .path_terminator(self.path_terminator.clone()) .per_match_one_line(true) .per_match(self.vimgrep) .replacement(self.replace.clone().map(|r| r.into())) .separator_context(self.context_separator.clone().into_bytes()) .separator_field_context( self.field_context_separator.clone().into_bytes(), ) .separator_field_match( self.field_match_separator.clone().into_bytes(), ) .separator_path(self.path_separator.clone()) .stats(self.stats.is_some()) .trim_ascii(self.trim); // When doing multi-threaded searching, the buffer writer is // responsible for writing separators since it is the only thing that // knows whether something has been printed or not. But for the single // threaded case, we don't use a buffer writer and thus can let the // printer own this. if self.threads == 1 { builder.separator_search(self.file_separator.clone()); } builder.build(wtr) } /// Builds a "summary" printer where search results are aggregated on a /// file-by-file basis. fn printer_summary( &self, wtr: W, kind: SummaryKind, ) -> grep::printer::Summary { grep::printer::SummaryBuilder::new() .color_specs(self.colors.clone()) .exclude_zero(!self.include_zero) .hyperlink(self.hyperlink_config.clone()) .kind(kind) .max_matches(self.max_count) .path(self.with_filename) .path_terminator(self.path_terminator.clone()) .separator_field(b":".to_vec()) .separator_path(self.path_separator.clone()) .stats(self.stats.is_some()) .build(wtr) } /// Returns true if ripgrep should operate in "quiet" mode. /// /// Generally speaking, quiet mode means that ripgrep should not print /// anything to stdout. There are some exceptions. For example, when the /// user has provided `--stats`, then ripgrep will print statistics to /// stdout. pub(crate) fn quiet(&self) -> bool { self.quiet } /// Returns true when ripgrep should stop searching after a single match is /// found. /// /// This is useful for example when quiet mode is enabled. In that case, /// users generally can't tell the difference in behavior between a search /// that finds all matches and a search that only finds one of them. (An /// exception here is if `--stats` is given, then `quit_after_match` will /// always return false since the user expects ripgrep to find everything.) pub(crate) fn quit_after_match(&self) -> bool { self.quit_after_match } /// Build a worker for executing searches. /// /// Search results are found using the given matcher and written to the /// given printer. pub(crate) fn search_worker( &self, matcher: PatternMatcher, searcher: grep::searcher::Searcher, printer: Printer, ) -> anyhow::Result> { let mut builder = SearchWorkerBuilder::new(); builder .preprocessor(self.pre.clone())? .preprocessor_globs(self.pre_globs.clone()) .search_zip(self.search_zip) .binary_detection_explicit(self.binary.explicit.clone()) .binary_detection_implicit(self.binary.implicit.clone()); Ok(builder.build(matcher, searcher, printer)) } /// Build a searcher from the command line parameters. pub(crate) fn searcher(&self) -> anyhow::Result { let line_term = if self.crlf { grep::matcher::LineTerminator::crlf() } else if self.null_data { grep::matcher::LineTerminator::byte(b'\x00') } else { grep::matcher::LineTerminator::byte(b'\n') }; let mut builder = grep::searcher::SearcherBuilder::new(); builder .line_terminator(line_term) .invert_match(self.invert_match) .line_number(self.line_number) .multi_line(self.multiline) .memory_map(self.mmap_choice.clone()) .stop_on_nonmatch(self.stop_on_nonmatch); match self.context { ContextMode::Passthru => { builder.passthru(true); } ContextMode::Limited(ref limited) => { let (before, after) = limited.get(); builder.before_context(before); builder.after_context(after); } } match self.encoding { EncodingMode::Auto => {} // default for the searcher EncodingMode::Some(ref enc) => { builder.encoding(Some(enc.clone())); } EncodingMode::Disabled => { builder.bom_sniffing(false); } } Ok(builder.build()) } /// Given an iterator of haystacks, sort them if necessary. /// /// When sorting is necessary, this will collect the entire iterator into /// memory, sort them and then return a new iterator. When sorting is not /// necessary, then the iterator given is returned as is without collecting /// it into memory. /// /// Once special case is when sorting by path in ascending order has been /// requested. In this case, the iterator given is returned as is without /// any additional sorting. This is done because `walk_builder()` will sort /// the iterator it yields during directory traversal, so no additional /// sorting is needed. pub(crate) fn sort<'a, I>( &self, haystacks: I, ) -> Box + 'a> where I: Iterator + 'a, { use std::{cmp::Ordering, fs::Metadata, io, time::SystemTime}; fn attach_timestamps( haystacks: impl Iterator, get: impl Fn(&Metadata) -> io::Result, ) -> impl Iterator)> { haystacks.map(move |s| { let time = s.path().metadata().and_then(|m| get(&m)).ok(); (s, time) }) } let Some(ref sort) = self.sort else { return Box::new(haystacks) }; let mut with_timestamps: Vec<_> = match sort.kind { SortModeKind::Path if !sort.reverse => return Box::new(haystacks), SortModeKind::Path => todo!(), SortModeKind::LastModified => { attach_timestamps(haystacks, |md| md.modified()).collect() } SortModeKind::LastAccessed => { attach_timestamps(haystacks, |md| md.accessed()).collect() } SortModeKind::Created => { attach_timestamps(haystacks, |md| md.created()).collect() } }; with_timestamps.sort_by(|(_, ref t1), (_, ref t2)| { let ordering = match (*t1, *t2) { // Both have metadata, do the obvious thing. (Some(t1), Some(t2)) => t1.cmp(&t2), // Things that error should appear later (when ascending). (Some(_), None) => Ordering::Less, // Things that error should appear later (when ascending). (None, Some(_)) => Ordering::Greater, // When both error, we can't distinguish, so treat as equal. (None, None) => Ordering::Equal, }; if sort.reverse { ordering.reverse() } else { ordering } }); Box::new(with_timestamps.into_iter().map(|(s, _)| s)) } /// Returns a stats object if the user requested that ripgrep keep track /// of various metrics during a search. /// /// When this returns `None`, then callers may assume that the user did /// not request statistics. pub(crate) fn stats(&self) -> Option { self.stats.clone() } /// Returns a color-enabled writer for stdout. /// /// The writer returned is also configured to do either line or block /// buffering, based on either explicit configuration from the user via CLI /// flags, or automatically based on whether stdout is connected to a tty. pub(crate) fn stdout(&self) -> grep::cli::StandardStream { let color = self.color.to_termcolor(); match self.buffer { BufferMode::Auto => { if self.is_terminal_stdout { grep::cli::stdout_buffered_line(color) } else { grep::cli::stdout_buffered_block(color) } } BufferMode::Line => grep::cli::stdout_buffered_line(color), BufferMode::Block => grep::cli::stdout_buffered_block(color), } } /// Returns the total number of threads ripgrep should use to execute a /// search. /// /// This number is the result of reasoning about both heuristics (like /// the available number of cores) and whether ripgrep's mode supports /// parallelism. It is intended that this number be used to directly /// determine how many threads to spawn. pub(crate) fn threads(&self) -> usize { self.threads } /// Returns the file type matcher that was built. /// /// The matcher includes both the default rules and any rules added by the /// user for this specific invocation. pub(crate) fn types(&self) -> &ignore::types::Types { &self.types } /// Create a new builder for recursive directory traversal. /// /// The builder returned can be used to start a single threaded or multi /// threaded directory traversal. For multi threaded traversal, the number /// of threads configured is equivalent to `HiArgs::threads`. /// /// If `HiArgs::threads` is equal to `1`, then callers should generally /// choose to explicitly use single threaded traversal since it won't have /// the unnecessary overhead of synchronization. pub(crate) fn walk_builder(&self) -> anyhow::Result { let mut builder = ignore::WalkBuilder::new(&self.paths.paths[0]); for path in self.paths.paths.iter().skip(1) { builder.add(path); } if !self.no_ignore_files { for path in self.ignore_file.iter() { if let Some(err) = builder.add_ignore(path) { ignore_message!("{err}"); } } } builder .max_depth(self.max_depth) .follow_links(self.follow) .max_filesize(self.max_filesize) .threads(self.threads) .same_file_system(self.one_file_system) .skip_stdout(matches!(self.mode, Mode::Search(_))) .overrides(self.globs.clone()) .types(self.types.clone()) .hidden(!self.hidden) .parents(!self.no_ignore_parent) .ignore(!self.no_ignore_dot) .git_global(!self.no_ignore_vcs && !self.no_ignore_global) .git_ignore(!self.no_ignore_vcs) .git_exclude(!self.no_ignore_vcs && !self.no_ignore_exclude) .require_git(!self.no_require_git) .ignore_case_insensitive(self.ignore_file_case_insensitive); if !self.no_ignore_dot { builder.add_custom_ignore_filename(".rgignore"); } // When we want to sort paths lexicographically in ascending order, // then we can actually do this during directory traversal itself. // Otherwise, sorting is done by collecting all paths, sorting them and // then searching them. if let Some(ref sort) = self.sort { assert_eq!(1, self.threads, "sorting implies single threaded"); if !sort.reverse && matches!(sort.kind, SortModeKind::Path) { builder.sort_by_file_name(|a, b| a.cmp(b)); } } Ok(builder) } } /// State that only needs to be computed once during argument parsing. /// /// This state is meant to be somewhat generic and shared across multiple /// low->high argument conversions. The state can even be mutated by various /// conversions as a way to communicate changes to other conversions. For /// example, reading patterns might consume from stdin. If we know stdin /// has been consumed and no other file paths have been given, then we know /// for sure that we should search the CWD. In this way, a state change /// when reading the patterns can impact how the file paths are ultimately /// generated. #[derive(Debug)] struct State { /// Whether it's believed that tty is connected to stdout. Note that on /// unix systems, this is always correct. On Windows, heuristics are used /// by Rust's standard library, particularly for cygwin/MSYS environments. is_terminal_stdout: bool, /// Whether stdin has already been consumed. This is useful to know and for /// providing good error messages when the user has tried to read from stdin /// in two different places. For example, `rg -f - -`. stdin_consumed: bool, /// The current working directory. cwd: PathBuf, } impl State { /// Initialize state to some sensible defaults. /// /// Note that the state values may change throughout the lifetime of /// argument parsing. fn new() -> anyhow::Result { use std::io::IsTerminal; Ok(State { is_terminal_stdout: std::io::stdout().is_terminal(), stdin_consumed: false, cwd: current_dir()?, }) } } /// The disjunction of patterns to search for. /// /// The number of patterns can be empty, e.g., via `-f /dev/null`. #[derive(Debug)] struct Patterns { /// The actual patterns to match. patterns: Vec, } impl Patterns { /// Pulls the patterns out of the low arguments. /// /// This includes collecting patterns from -e/--regexp and -f/--file. /// /// If the invocation implies that the first positional argument is a /// pattern (the common case), then the first positional argument is /// extracted as well. fn from_low_args( state: &mut State, low: &mut LowArgs, ) -> anyhow::Result { // The first positional is only a pattern when ripgrep is instructed to // search and neither -e/--regexp nor -f/--file is given. Basically, // the first positional is a pattern only when a pattern hasn't been // given in some other way. // No search means no patterns. Even if -e/--regexp or -f/--file is // given, we know we won't use them so don't bother collecting them. if !matches!(low.mode, Mode::Search(_)) { return Ok(Patterns { patterns: vec![] }); } // If we got nothing from -e/--regexp and -f/--file, then the first // positional is a pattern. if low.patterns.is_empty() { anyhow::ensure!( !low.positional.is_empty(), "ripgrep requires at least one pattern to execute a search" ); let ospat = low.positional.remove(0); let Ok(pat) = ospat.into_string() else { anyhow::bail!("pattern given is not valid UTF-8") }; return Ok(Patterns { patterns: vec![pat] }); } // Otherwise, we need to slurp up our patterns from -e/--regexp and // -f/--file. We de-duplicate as we go. If we don't de-duplicate, // then it can actually lead to major slow downs for sloppy inputs. // This might be surprising, and the regex engine will eventually // de-duplicate duplicative branches in a single regex (maybe), but // not until after it has gone through parsing and some other layers. // If there are a lot of duplicates, then that can lead to a sizeable // extra cost. It is lamentable that we pay the extra cost here to // de-duplicate for a likely uncommon case, but I've seen this have a // big impact on real world data. let mut seen = HashSet::new(); let mut patterns = Vec::with_capacity(low.patterns.len()); let mut add = |pat: String| { if !seen.contains(&pat) { seen.insert(pat.clone()); patterns.push(pat); } }; for source in low.patterns.drain(..) { match source { PatternSource::Regexp(pat) => add(pat), PatternSource::File(path) => { if path == Path::new("-") { anyhow::ensure!( !state.stdin_consumed, "error reading -f/--file from stdin: stdin \ has already been consumed" ); for pat in grep::cli::patterns_from_stdin()? { add(pat); } state.stdin_consumed = true; } else { for pat in grep::cli::patterns_from_path(&path)? { add(pat); } } } } } Ok(Patterns { patterns }) } } /// The collection of paths we want to search for. /// /// This guarantees that there is always at least one path. #[derive(Debug)] struct Paths { /// The actual paths. paths: Vec, /// This is true when ripgrep had to guess to search the current working /// directory. e.g., When the user just runs `rg foo`. It is odd to need /// this, but it subtly changes how the paths are printed. When no explicit /// path is given, then ripgrep doesn't prefix each path with `./`. But /// otherwise it does! This curious behavior matches what GNU grep does. has_implicit_path: bool, /// Set to true if it is known that only a single file descriptor will /// be searched. is_one_file: bool, } impl Paths { /// Drain the search paths out of the given low arguments. fn from_low_args( state: &mut State, _: &Patterns, low: &mut LowArgs, ) -> anyhow::Result { // We require a `&Patterns` even though we don't use it to ensure that // patterns have already been read from LowArgs. This let's us safely // assume that all remaining positional arguments are intended to be // file paths. let mut paths = Vec::with_capacity(low.positional.len()); for osarg in low.positional.drain(..) { let path = PathBuf::from(osarg); if state.stdin_consumed && path == Path::new("-") { anyhow::bail!( "error: attempted to read patterns from stdin \ while also searching stdin", ); } paths.push(path); } if !paths.is_empty() { let is_one_file = paths.len() == 1 && (paths[0] == Path::new("-") || paths[0].is_file()); return Ok(Paths { paths, has_implicit_path: false, is_one_file }); } // N.B. is_readable_stdin is a heuristic! Part of the issue is that a // lot of "exec process" APIs will open a stdin pipe even though stdin // isn't really being used. ripgrep then thinks it should search stdin // and one gets the appearance of it hanging. It's a terrible failure // mode, but there really is no good way to mitigate it. It's just a // consequence of letting the user type 'rg foo' and "guessing" that // they meant to search the CWD. let is_readable_stdin = grep::cli::is_readable_stdin(); let use_cwd = !is_readable_stdin || state.stdin_consumed || !matches!(low.mode, Mode::Search(_)); log::debug!( "using heuristics to determine whether to read from \ stdin or search ./ (\ is_readable_stdin={is_readable_stdin}, \ stdin_consumed={stdin_consumed}, \ mode={mode:?})", stdin_consumed = state.stdin_consumed, mode = low.mode, ); let (path, is_one_file) = if use_cwd { log::debug!("heuristic chose to search ./"); (PathBuf::from("./"), false) } else { log::debug!("heuristic chose to search stdin"); (PathBuf::from("-"), true) }; Ok(Paths { paths: vec![path], has_implicit_path: true, is_one_file }) } /// Returns true if ripgrep will only search stdin and nothing else. fn is_only_stdin(&self) -> bool { self.paths.len() == 1 && self.paths[0] == Path::new("-") } } /// The "binary detection" configuration that ripgrep should use. /// /// ripgrep actually uses two different binary detection heuristics depending /// on whether a file is explicitly being searched (e.g., via a CLI argument) /// or implicitly searched (e.g., via directory traversal). In general, the /// former can never use a heuristic that lets it "quit" seaching before /// either getting EOF or finding a match. (Because doing otherwise would be /// considered a filter, and ripgrep follows the rule that an explicitly given /// file is always searched.) #[derive(Debug)] struct BinaryDetection { explicit: grep::searcher::BinaryDetection, implicit: grep::searcher::BinaryDetection, } impl BinaryDetection { /// Determines the correct binary detection mode from low-level arguments. fn from_low_args(_: &State, low: &LowArgs) -> BinaryDetection { let none = matches!(low.binary, BinaryMode::AsText) || low.null_data; let convert = matches!(low.binary, BinaryMode::SearchAndSuppress); let explicit = if none { grep::searcher::BinaryDetection::none() } else { grep::searcher::BinaryDetection::convert(b'\x00') }; let implicit = if none { grep::searcher::BinaryDetection::none() } else if convert { grep::searcher::BinaryDetection::convert(b'\x00') } else { grep::searcher::BinaryDetection::quit(b'\x00') }; BinaryDetection { explicit, implicit } } } /// Builds the file type matcher from low level arguments. fn types(low: &LowArgs) -> anyhow::Result { let mut builder = ignore::types::TypesBuilder::new(); builder.add_defaults(); for tychange in low.type_changes.iter() { match tychange { TypeChange::Clear { ref name } => { builder.clear(name); } TypeChange::Add { ref def } => { builder.add_def(def)?; } TypeChange::Select { ref name } => { builder.select(name); } TypeChange::Negate { ref name } => { builder.negate(name); } } } Ok(builder.build()?) } /// Builds the glob "override" matcher from the CLI `-g/--glob` and `--iglob` /// flags. fn globs( state: &State, low: &LowArgs, ) -> anyhow::Result { if low.globs.is_empty() && low.iglobs.is_empty() { return Ok(ignore::overrides::Override::empty()); } let mut builder = ignore::overrides::OverrideBuilder::new(&state.cwd); // Make all globs case insensitive with --glob-case-insensitive. if low.glob_case_insensitive { builder.case_insensitive(true).unwrap(); } for glob in low.globs.iter() { builder.add(glob)?; } // This only enables case insensitivity for subsequent globs. builder.case_insensitive(true).unwrap(); for glob in low.iglobs.iter() { builder.add(&glob)?; } Ok(builder.build()?) } /// Builds a glob matcher for all of the preprocessor globs (via `--pre-glob`). fn preprocessor_globs( state: &State, low: &LowArgs, ) -> anyhow::Result { if low.pre_glob.is_empty() { return Ok(ignore::overrides::Override::empty()); } let mut builder = ignore::overrides::OverrideBuilder::new(&state.cwd); for glob in low.pre_glob.iter() { builder.add(glob)?; } Ok(builder.build()?) } /// Determines whether stats should be tracked for this search. If so, a stats /// object is returned. fn stats(low: &LowArgs) -> Option { if !matches!(low.mode, Mode::Search(_)) { return None; } if low.stats || matches!(low.mode, Mode::Search(SearchMode::JSON)) { return Some(grep::printer::Stats::new()); } None } /// Pulls out any color specs provided by the user and assembles them into one /// single configuration. fn take_color_specs(_: &mut State, low: &mut LowArgs) -> ColorSpecs { let mut specs = grep::printer::default_color_specs(); for spec in low.colors.drain(..) { specs.push(spec); } ColorSpecs::new(&specs) } /// Pulls out the necessary info from the low arguments to build a full /// hyperlink configuration. fn take_hyperlink_config( _: &mut State, low: &mut LowArgs, ) -> anyhow::Result { let mut env = grep::printer::HyperlinkEnvironment::new(); if let Some(hostname) = hostname(low.hostname_bin.as_deref()) { log::debug!("found hostname for hyperlink configuration: {hostname}"); env.host(Some(hostname)); } if let Some(wsl_prefix) = wsl_prefix() { log::debug!( "found wsl_prefix for hyperlink configuration: {wsl_prefix}" ); env.wsl_prefix(Some(wsl_prefix)); } let fmt = std::mem::take(&mut low.hyperlink_format); log::debug!("hyperlink format: {:?}", fmt.to_string()); Ok(grep::printer::HyperlinkConfig::new(env, fmt)) } /// Attempts to discover the current working directory. /// /// This mostly just defers to the standard library, however, such things will /// fail if ripgrep is in a directory that no longer exists. We attempt some /// fallback mechanisms, such as querying the PWD environment variable, but /// otherwise return an error. fn current_dir() -> anyhow::Result { let err = match std::env::current_dir() { Err(err) => err, Ok(cwd) => return Ok(cwd), }; if let Some(cwd) = std::env::var_os("PWD") { if !cwd.is_empty() { return Ok(PathBuf::from(cwd)); } } anyhow::bail!( "failed to get current working directory: {err}\n\ did your CWD get deleted?", ) } /// Retrieves the hostname that should be used wherever a hostname is required. /// /// Currently, this is only used in the hyperlink format. /// /// This works by first running the given binary program (if present and with /// no arguments) to get the hostname after trimming leading and trailing /// whitespace. If that fails for any reason, then it falls back to getting /// the hostname via platform specific means (e.g., `gethostname` on Unix). /// /// The purpose of `bin` is to make it possible for end users to override how /// ripgrep determines the hostname. fn hostname(bin: Option<&Path>) -> Option { let Some(bin) = bin else { return platform_hostname() }; let bin = match grep::cli::resolve_binary(bin) { Ok(bin) => bin, Err(err) => { log::debug!( "failed to run command '{bin:?}' to get hostname \ (falling back to platform hostname): {err}", ); return platform_hostname(); } }; let mut cmd = std::process::Command::new(&bin); cmd.stdin(std::process::Stdio::null()); let rdr = match grep::cli::CommandReader::new(&mut cmd) { Ok(rdr) => rdr, Err(err) => { log::debug!( "failed to spawn command '{bin:?}' to get \ hostname (falling back to platform hostname): {err}", ); return platform_hostname(); } }; let out = match std::io::read_to_string(rdr) { Ok(out) => out, Err(err) => { log::debug!( "failed to read output from command '{bin:?}' to get \ hostname (falling back to platform hostname): {err}", ); return platform_hostname(); } }; let hostname = out.trim(); if hostname.is_empty() { log::debug!( "output from command '{bin:?}' is empty after trimming \ leading and trailing whitespace (falling back to \ platform hostname)", ); return platform_hostname(); } Some(hostname.to_string()) } /// Attempts to get the hostname by using platform specific routines. /// /// For example, this will do `gethostname` on Unix and `GetComputerNameExW` on /// Windows. fn platform_hostname() -> Option { let hostname_os = match grep::cli::hostname() { Ok(x) => x, Err(err) => { log::debug!("could not get hostname: {}", err); return None; } }; let Some(hostname) = hostname_os.to_str() else { log::debug!( "got hostname {:?}, but it's not valid UTF-8", hostname_os ); return None; }; Some(hostname.to_string()) } /// Returns the value for the `{wslprefix}` variable in a hyperlink format. /// /// A WSL prefix is a share/network like thing that is meant to permit Windows /// applications to open files stored within a WSL drive. /// /// If a WSL distro name is unavailable, not valid UTF-8 or this isn't running /// in a Unix environment, then this returns None. /// /// See: fn wsl_prefix() -> Option { if !cfg!(unix) { return None; } let distro_os = std::env::var_os("WSL_DISTRO_NAME")?; let Some(distro) = distro_os.to_str() else { log::debug!( "found WSL_DISTRO_NAME={:?}, but value is not UTF-8", distro_os ); return None; }; Some(format!("wsl$/{distro}")) } /// Possibly suggest another regex engine based on the error message given. /// /// This inspects an error resulting from building a Rust regex matcher, and /// if it's believed to correspond to a syntax error that another engine could /// handle, then add a message to suggest the use of the engine flag. fn suggest_other_engine(msg: String) -> String { if let Some(pcre_msg) = suggest_pcre2(&msg) { return pcre_msg; } msg } /// Possibly suggest PCRE2 based on the error message given. /// /// Inspect an error resulting from building a Rust regex matcher, and if it's /// believed to correspond to a syntax error that PCRE2 could handle, then /// add a message to suggest the use of -P/--pcre2. fn suggest_pcre2(msg: &str) -> Option { if !cfg!(feature = "pcre2") { return None; } if !msg.contains("backreferences") && !msg.contains("look-around") { None } else { Some(format!( "{msg} Consider enabling PCRE2 with the --pcre2 flag, which can handle backreferences and look-around.", )) } } /// Possibly suggest multiline mode based on the error message given. /// /// Does a bit of a hacky inspection of the given error message, and if it /// looks like the user tried to type a literal line terminator then it will /// return a new error message suggesting the use of -U/--multiline. fn suggest_multiline(msg: String) -> String { if msg.contains("the literal") && msg.contains("not allowed") { format!( "{msg} Consider enabling multiline mode with the --multiline flag (or -U for short). When multiline mode is enabled, new line characters can be matched.", ) } else { msg } }